C22H18N2O2 — CID 835095
1-(4-ethoxyphenyl)-N-(2-phenyl-1,3-benzoxazol-5-yl)methanimine (PubChem CID 835095) has the molecular formula C22H18N2O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-N-(2-phenyl-1,3-benzoxazol-5-yl)methanimine.
| Compound Name | 1-(4-ethoxyphenyl)-N-(2-phenyl-1,3-benzoxazol-5-yl)methanimine |
|---|---|
| PubChem CID | 835095 |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-(4-ethoxyphenyl)-N-(2-phenyl-1,3-benzoxazol-5-yl)methanimine |
| SMILES | CCOc1ccc(/C=N/c2ccc3oc(-c4ccccc4)nc3c2)cc1 |
| InChI | InChI=1S/C22H18N2O2/c1-2-25-19-11-8-16(9-12-19)15-23-18-10-13-21-20(14-18)24-22(26-21)17-6-4-3-5-7-17/h3-15H,2H2,1H3/b23-15+ |
| InChIKey | PWFDZLHOGRCMTG-HZHRSRAPSA-N |
| XLogP | 5.64 |
| TPSA | 47.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|