C22H19NO2 — CID 102448915
2-[4-(4-ethoxyphenyl)phenyl]-5-methyl-1,3-benzoxazole (PubChem CID 102448915) has the molecular formula C22H19NO2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-[4-(4-ethoxyphenyl)phenyl]-5-methyl-1,3-benzoxazole.
| Compound Name | 2-[4-(4-ethoxyphenyl)phenyl]-5-methyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 102448915 |
| Molecular Formula | C22H19NO2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-[4-(4-ethoxyphenyl)phenyl]-5-methyl-1,3-benzoxazole |
| SMILES | CCOc1ccc(-c2ccc(-c3nc4cc(C)ccc4o3)cc2)cc1 |
| InChI | InChI=1S/C22H19NO2/c1-3-24-19-11-9-17(10-12-19)16-5-7-18(8-6-16)22-23-20-14-15(2)4-13-21(20)25-22/h4-14H,3H2,1-2H3 |
| InChIKey | KHWZKYGKUOXATI-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |