C31H28N2O2 — CID 4550659
N-[2-(4-tert-butylphenyl)-1,3-benzoxazol-5-yl]-1-(4-phenylmethoxyphenyl)methanimine (PubChem CID 4550659) has the molecular formula C31H28N2O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenyl)-1,3-benzoxazol-5-yl]-1-(4-phenylmethoxyphenyl)methanimine.
| Compound Name | N-[2-(4-tert-butylphenyl)-1,3-benzoxazol-5-yl]-1-(4-phenylmethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 4550659 |
| Molecular Formula | C31H28N2O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | N-[2-(4-tert-butylphenyl)-1,3-benzoxazol-5-yl]-1-(4-phenylmethoxyphenyl)methanimine |
| SMILES | CC(C)(C)c1ccc(-c2nc3cc(/N=C/c4ccc(OCc5ccccc5)cc4)ccc3o2)cc1 |
| InChI | InChI=1S/C31H28N2O2/c1-31(2,3)25-13-11-24(12-14-25)30-33-28-19-26(15-18-29(28)35-30)32-20-22-9-16-27(17-10-22)34-21-23-7-5-4-6-8-23/h4-20H,21H2,1-3H3/b32-20+ |
| InChIKey | JMIBKOKKNBRSTQ-UZWMFBFFSA-N |
| XLogP | 8.12 |
| TPSA | 47.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|