C30H24N4O6 — CID 4052344
N-[2-(4-tert-butylphenyl)-1,3-benzoxazol-5-yl]-1-[3-(2,4-dinitrophenoxy)phenyl]methanimine (PubChem CID 4052344) has the molecular formula C30H24N4O6 and a molecular weight of 536.54 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenyl)-1,3-benzoxazol-5-yl]-1-[3-(2,4-dinitrophenoxy)phenyl]methanimine.
| Compound Name | N-[2-(4-tert-butylphenyl)-1,3-benzoxazol-5-yl]-1-[3-(2,4-dinitrophenoxy)phenyl]methanimine |
|---|---|
| PubChem CID | 4052344 |
| Molecular Formula | C30H24N4O6 |
| Molecular Weight | 536.54 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | N-[2-(4-tert-butylphenyl)-1,3-benzoxazol-5-yl]-1-[3-(2,4-dinitrophenoxy)phenyl]methanimine |
| SMILES | CC(C)(C)c1ccc(-c2nc3cc(/N=C/c4cccc(Oc5ccc([N+](=O)[O-])cc5[N+](=O)[O-])c4)ccc3o2)cc1 |
| InChI | InChI=1S/C30H24N4O6/c1-30(2,3)21-9-7-20(8-10-21)29-32-25-16-22(11-13-27(25)40-29)31-18-19-5-4-6-24(15-19)39-28-14-12-23(33(35)36)17-26(28)34(37)38/h4-18H,1-3H3/b31-18+ |
| InChIKey | JOFLCGJATJSGFA-FDAWAROLSA-N |
| XLogP | 8.15 |
| TPSA | 133.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.54 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|