C28H19FN4O7 — CID 4183153
1-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]-N-[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]methanimine (PubChem CID 4183153) has the molecular formula C28H19FN4O7 and a molecular weight of 542.48 g/mol. Its IUPAC name is 1-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]-N-[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]methanimine.
| Compound Name | 1-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]-N-[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]methanimine |
|---|---|
| PubChem CID | 4183153 |
| Molecular Formula | C28H19FN4O7 |
| Molecular Weight | 542.48 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | 1-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]-N-[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]methanimine |
| SMILES | CCOc1cc(/C=N/c2ccc3oc(-c4cccc(F)c4)nc3c2)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H19FN4O7/c1-2-38-27-12-17(6-9-26(27)39-25-11-8-21(32(34)35)15-23(25)33(36)37)16-30-20-7-10-24-22(14-20)31-28(40-24)18-4-3-5-19(29)13-18/h3-16H,2H2,1H3/b30-16+ |
| InChIKey | UFUUMBQYGSPVAL-OKCVXOCRSA-N |
| XLogP | 7.39 |
| TPSA | 143.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.48 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|