C28H20N4O6 — CID 3442925
N-[2-(3,4-dimethylphenyl)-1,3-benzoxazol-5-yl]-1-[3-(2,4-dinitrophenoxy)phenyl]methanimine (PubChem CID 3442925) has the molecular formula C28H20N4O6 and a molecular weight of 508.49 g/mol. Its IUPAC name is N-[2-(3,4-dimethylphenyl)-1,3-benzoxazol-5-yl]-1-[3-(2,4-dinitrophenoxy)phenyl]methanimine.
| Compound Name | N-[2-(3,4-dimethylphenyl)-1,3-benzoxazol-5-yl]-1-[3-(2,4-dinitrophenoxy)phenyl]methanimine |
|---|---|
| PubChem CID | 3442925 |
| Molecular Formula | C28H20N4O6 |
| Molecular Weight | 508.49 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | N-[2-(3,4-dimethylphenyl)-1,3-benzoxazol-5-yl]-1-[3-(2,4-dinitrophenoxy)phenyl]methanimine |
| SMILES | Cc1ccc(-c2nc3cc(/N=C/c4cccc(Oc5ccc([N+](=O)[O-])cc5[N+](=O)[O-])c4)ccc3o2)cc1C |
| InChI | InChI=1S/C28H20N4O6/c1-17-6-7-20(12-18(17)2)28-30-24-14-21(8-10-26(24)38-28)29-16-19-4-3-5-23(13-19)37-27-11-9-22(31(33)34)15-25(27)32(35)36/h3-16H,1-2H3/b29-16+ |
| InChIKey | MVPAXRIXQGUCSR-MUFRIFMGSA-N |
| XLogP | 7.47 |
| TPSA | 133.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.49 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|