C26H15BrN4O7 — CID 171978854
2-(1,3-benzoxazol-2-yl)-5-[[3-bromo-4-(2,4-dinitrophenoxy)phenyl]methylideneamino]phenol (PubChem CID 171978854) has the molecular formula C26H15BrN4O7 and a molecular weight of 575.33 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-5-[[3-bromo-4-(2,4-dinitrophenoxy)phenyl]methylideneamino]phenol.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-5-[[3-bromo-4-(2,4-dinitrophenoxy)phenyl]methylideneamino]phenol |
|---|---|
| PubChem CID | 171978854 |
| Molecular Formula | C26H15BrN4O7 |
| Molecular Weight | 575.33 g/mol |
| Exact Mass | 574.01 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-5-[[3-bromo-4-(2,4-dinitrophenoxy)phenyl]methylideneamino]phenol |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc(/C=N/c3ccc(-c4nc5ccccc5o4)c(O)c3)cc2Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H15BrN4O7/c27-19-11-15(5-9-23(19)37-25-10-7-17(30(33)34)13-21(25)31(35)36)14-28-16-6-8-18(22(32)12-16)26-29-20-3-1-2-4-24(20)38-26/h1-14,32H/b28-14+ |
| InChIKey | POJHOLAQNQZVLY-CCVNUDIWSA-N |
| XLogP | 7.32 |
| TPSA | 154.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.33 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|