C19H11N3O6 — CID 134347255
2-[5-nitro-2-(4-nitrophenoxy)phenyl]-1,3-benzoxazole (PubChem CID 134347255) has the molecular formula C19H11N3O6 and a molecular weight of 377.31 g/mol. Its IUPAC name is 2-[5-nitro-2-(4-nitrophenoxy)phenyl]-1,3-benzoxazole.
| Compound Name | 2-[5-nitro-2-(4-nitrophenoxy)phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 134347255 |
| Molecular Formula | C19H11N3O6 |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 2-[5-nitro-2-(4-nitrophenoxy)phenyl]-1,3-benzoxazole |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc([N+](=O)[O-])cc2-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C19H11N3O6/c23-21(24)12-5-8-14(9-6-12)27-17-10-7-13(22(25)26)11-15(17)19-20-16-3-1-2-4-18(16)28-19/h1-11H |
| InChIKey | LAVJUWLCSFWDPU-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 121.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|