C15H12N2O5 — CID 91684001
2-(2,3-dimethoxyphenyl)-6-nitro-1,3-benzoxazole (PubChem CID 91684001) has the molecular formula C15H12N2O5 and a molecular weight of 300.27 g/mol. Its IUPAC name is 2-(2,3-dimethoxyphenyl)-6-nitro-1,3-benzoxazole.
| Compound Name | 2-(2,3-dimethoxyphenyl)-6-nitro-1,3-benzoxazole |
|---|---|
| PubChem CID | 91684001 |
| Molecular Formula | C15H12N2O5 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2-(2,3-dimethoxyphenyl)-6-nitro-1,3-benzoxazole |
| SMILES | COc1cccc(-c2nc3ccc([N+](=O)[O-])cc3o2)c1OC |
| InChI | InChI=1S/C15H12N2O5/c1-20-12-5-3-4-10(14(12)21-2)15-16-11-7-6-9(17(18)19)8-13(11)22-15/h3-8H,1-2H3 |
| InChIKey | WPRSDUYEKFJFEV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 87.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|