C20H11N5O8 — CID 5048093
3,5-dinitro-N-[2-(6-nitro-1,3-benzoxazol-2-yl)phenyl]benzamide (PubChem CID 5048093) has the molecular formula C20H11N5O8 and a molecular weight of 449.34 g/mol. Its IUPAC name is 3,5-dinitro-N-[2-(6-nitro-1,3-benzoxazol-2-yl)phenyl]benzamide.
| Compound Name | 3,5-dinitro-N-[2-(6-nitro-1,3-benzoxazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 5048093 |
| Molecular Formula | C20H11N5O8 |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | 3,5-dinitro-N-[2-(6-nitro-1,3-benzoxazol-2-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1-c1nc2ccc([N+](=O)[O-])cc2o1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H11N5O8/c26-19(11-7-13(24(29)30)9-14(8-11)25(31)32)21-16-4-2-1-3-15(16)20-22-17-6-5-12(23(27)28)10-18(17)33-20/h1-10H,(H,21,26) |
| InChIKey | HRDFWVYMBYQBAZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 184.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|