C27H22N4O6 — CID 4533523
2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[2-(6-nitro-1,3-benzoxazol-2-yl)phenyl]pentanamide (PubChem CID 4533523) has the molecular formula C27H22N4O6 and a molecular weight of 498.50 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[2-(6-nitro-1,3-benzoxazol-2-yl)phenyl]pentanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[2-(6-nitro-1,3-benzoxazol-2-yl)phenyl]pentanamide |
|---|---|
| PubChem CID | 4533523 |
| Molecular Formula | C27H22N4O6 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-4-methyl-N-[2-(6-nitro-1,3-benzoxazol-2-yl)phenyl]pentanamide |
| SMILES | CC(C)CC(C(=O)Nc1ccccc1-c1nc2ccc([N+](=O)[O-])cc2o1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H22N4O6/c1-15(2)13-22(30-26(33)17-7-3-4-8-18(17)27(30)34)24(32)28-20-10-6-5-9-19(20)25-29-21-12-11-16(31(35)36)14-23(21)37-25/h3-12,14-15,22H,13H2,1-2H3,(H,28,32) |
| InChIKey | URGJBQCMFMPFKK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 135.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|