C24H27N3O4 — CID 4096409
4-butyl-N-[2-(6-nitro-1,3-benzoxazol-2-yl)phenyl]cyclohexane-1-carboxamide (PubChem CID 4096409) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 4-butyl-N-[2-(6-nitro-1,3-benzoxazol-2-yl)phenyl]cyclohexane-1-carboxamide.
| Compound Name | 4-butyl-N-[2-(6-nitro-1,3-benzoxazol-2-yl)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 4096409 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 4-butyl-N-[2-(6-nitro-1,3-benzoxazol-2-yl)phenyl]cyclohexane-1-carboxamide |
| SMILES | CCCCC1CCC(C(=O)Nc2ccccc2-c2nc3ccc([N+](=O)[O-])cc3o2)CC1 |
| InChI | InChI=1S/C24H27N3O4/c1-2-3-6-16-9-11-17(12-10-16)23(28)25-20-8-5-4-7-19(20)24-26-21-14-13-18(27(29)30)15-22(21)31-24/h4-5,7-8,13-17H,2-3,6,9-12H2,1H3,(H,25,28) |
| InChIKey | XYUBMESBHKZBQH-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|