C26H17N3O4 — CID 3646592
N-[2-(6-nitro-1,3-benzoxazol-2-yl)phenyl]-4-phenylbenzamide (PubChem CID 3646592) has the molecular formula C26H17N3O4 and a molecular weight of 435.44 g/mol. Its IUPAC name is N-[2-(6-nitro-1,3-benzoxazol-2-yl)phenyl]-4-phenylbenzamide.
| Compound Name | N-[2-(6-nitro-1,3-benzoxazol-2-yl)phenyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 3646592 |
| Molecular Formula | C26H17N3O4 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | N-[2-(6-nitro-1,3-benzoxazol-2-yl)phenyl]-4-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1-c1nc2ccc([N+](=O)[O-])cc2o1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H17N3O4/c30-25(19-12-10-18(11-13-19)17-6-2-1-3-7-17)27-22-9-5-4-8-21(22)26-28-23-15-14-20(29(31)32)16-24(23)33-26/h1-16H,(H,27,30) |
| InChIKey | NGBPOJRRJUSACT-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|