C28H21N3O4 — CID 4524647
N-[2-(5-nitro-1,3-benzoxazol-2-yl)phenyl]-2-(2-phenylethyl)benzamide (PubChem CID 4524647) has the molecular formula C28H21N3O4 and a molecular weight of 463.49 g/mol. Its IUPAC name is N-[2-(5-nitro-1,3-benzoxazol-2-yl)phenyl]-2-(2-phenylethyl)benzamide.
| Compound Name | N-[2-(5-nitro-1,3-benzoxazol-2-yl)phenyl]-2-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 4524647 |
| Molecular Formula | C28H21N3O4 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | N-[2-(5-nitro-1,3-benzoxazol-2-yl)phenyl]-2-(2-phenylethyl)benzamide |
| SMILES | O=C(Nc1ccccc1-c1nc2cc([N+](=O)[O-])ccc2o1)c1ccccc1CCc1ccccc1 |
| InChI | InChI=1S/C28H21N3O4/c32-27(22-11-5-4-10-20(22)15-14-19-8-2-1-3-9-19)29-24-13-7-6-12-23(24)28-30-25-18-21(31(33)34)16-17-26(25)35-28/h1-13,16-18H,14-15H2,(H,29,32) |
| InChIKey | FATUHPYCCCQBNC-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|