C20H12N4O6 — CID 3646590
4-nitro-N-[2-(6-nitro-1,3-benzoxazol-2-yl)phenyl]benzamide (PubChem CID 3646590) has the molecular formula C20H12N4O6 and a molecular weight of 404.34 g/mol. Its IUPAC name is 4-nitro-N-[2-(6-nitro-1,3-benzoxazol-2-yl)phenyl]benzamide.
| Compound Name | 4-nitro-N-[2-(6-nitro-1,3-benzoxazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 3646590 |
| Molecular Formula | C20H12N4O6 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 4-nitro-N-[2-(6-nitro-1,3-benzoxazol-2-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1-c1nc2ccc([N+](=O)[O-])cc2o1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H12N4O6/c25-19(12-5-7-13(8-6-12)23(26)27)21-16-4-2-1-3-15(16)20-22-17-10-9-14(24(28)29)11-18(17)30-20/h1-11H,(H,21,25) |
| InChIKey | VKJLSYPLICGOJP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 141.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|