C22H23N3O4 — CID 4058209
3-cyclohexyl-N-[2-(6-nitro-1,3-benzoxazol-2-yl)phenyl]propanamide (PubChem CID 4058209) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 3-cyclohexyl-N-[2-(6-nitro-1,3-benzoxazol-2-yl)phenyl]propanamide.
| Compound Name | 3-cyclohexyl-N-[2-(6-nitro-1,3-benzoxazol-2-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 4058209 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 3-cyclohexyl-N-[2-(6-nitro-1,3-benzoxazol-2-yl)phenyl]propanamide |
| SMILES | O=C(CCC1CCCCC1)Nc1ccccc1-c1nc2ccc([N+](=O)[O-])cc2o1 |
| InChI | InChI=1S/C22H23N3O4/c26-21(13-10-15-6-2-1-3-7-15)23-18-9-5-4-8-17(18)22-24-19-12-11-16(25(27)28)14-20(19)29-22/h4-5,8-9,11-12,14-15H,1-3,6-7,10,13H2,(H,23,26) |
| InChIKey | JIHDVJVHXUWXGV-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|