C21H11N3O5 — CID 3098445
2-[4-(1,3-benzoxazol-2-yl)phenyl]-5-nitroisoindole-1,3-dione (PubChem CID 3098445) has the molecular formula C21H11N3O5 and a molecular weight of 385.34 g/mol. Its IUPAC name is 2-[4-(1,3-benzoxazol-2-yl)phenyl]-5-nitroisoindole-1,3-dione.
| Compound Name | 2-[4-(1,3-benzoxazol-2-yl)phenyl]-5-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 3098445 |
| Molecular Formula | C21H11N3O5 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 2-[4-(1,3-benzoxazol-2-yl)phenyl]-5-nitroisoindole-1,3-dione |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2C(=O)N1c1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C21H11N3O5/c25-20-15-10-9-14(24(27)28)11-16(15)21(26)23(20)13-7-5-12(6-8-13)19-22-17-3-1-2-4-18(17)29-19/h1-11H |
| InChIKey | QNKHCKYCJGHEJM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 106.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|