C21H12N2O3 — CID 168517971
2-(2-phenyl-1,3-benzoxazol-6-yl)isoindole-1,3-dione (PubChem CID 168517971) has the molecular formula C21H12N2O3 and a molecular weight of 340.34 g/mol. Its IUPAC name is 2-(2-phenyl-1,3-benzoxazol-6-yl)isoindole-1,3-dione.
| Compound Name | 2-(2-phenyl-1,3-benzoxazol-6-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 168517971 |
| Molecular Formula | C21H12N2O3 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 2-(2-phenyl-1,3-benzoxazol-6-yl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1ccc2nc(-c3ccccc3)oc2c1 |
| InChI | InChI=1S/C21H12N2O3/c24-20-15-8-4-5-9-16(15)21(25)23(20)14-10-11-17-18(12-14)26-19(22-17)13-6-2-1-3-7-13/h1-12H |
| InChIKey | BRCWVZITBMMKIM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|