C17H11FN2O — CID 91675069
2-(4-fluorophenyl)-6-pyrrol-1-yl-1,3-benzoxazole (PubChem CID 91675069) has the molecular formula C17H11FN2O and a molecular weight of 278.29 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-6-pyrrol-1-yl-1,3-benzoxazole.
| Compound Name | 2-(4-fluorophenyl)-6-pyrrol-1-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 91675069 |
| Molecular Formula | C17H11FN2O |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-(4-fluorophenyl)-6-pyrrol-1-yl-1,3-benzoxazole |
| SMILES | Fc1ccc(-c2nc3ccc(-n4cccc4)cc3o2)cc1 |
| InChI | InChI=1S/C17H11FN2O/c18-13-5-3-12(4-6-13)17-19-15-8-7-14(11-16(15)21-17)20-9-1-2-10-20/h1-11H |
| InChIKey | ILGXEWOUDUARML-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |