C17H12N2O — CID 91677444
2-(4-pyrrol-1-ylphenyl)-1,3-benzoxazole (PubChem CID 91677444) has the molecular formula C17H12N2O and a molecular weight of 260.30 g/mol. Its IUPAC name is 2-(4-pyrrol-1-ylphenyl)-1,3-benzoxazole.
| Compound Name | 2-(4-pyrrol-1-ylphenyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 91677444 |
| Molecular Formula | C17H12N2O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 2-(4-pyrrol-1-ylphenyl)-1,3-benzoxazole |
| SMILES | c1ccc2oc(-c3ccc(-n4cccc4)cc3)nc2c1 |
| InChI | InChI=1S/C17H12N2O/c1-2-6-16-15(5-1)18-17(20-16)13-7-9-14(10-8-13)19-11-3-4-12-19/h1-12H |
| InChIKey | CNXAMLPQQWXPNH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_G(4)', 'substructure': 'N/A'} |
|---|