C15H12BrNO — CID 23459165
2-[4-(1-bromoethyl)phenyl]-1,3-benzoxazole (PubChem CID 23459165) has the molecular formula C15H12BrNO and a molecular weight of 302.17 g/mol. Its IUPAC name is 2-[4-(1-bromoethyl)phenyl]-1,3-benzoxazole.
| Compound Name | 2-[4-(1-bromoethyl)phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 23459165 |
| Molecular Formula | C15H12BrNO |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 2-[4-(1-bromoethyl)phenyl]-1,3-benzoxazole |
| SMILES | CC(Br)c1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C15H12BrNO/c1-10(16)11-6-8-12(9-7-11)15-17-13-4-2-3-5-14(13)18-15/h2-10H,1H3 |
| InChIKey | HGHGWDSLOJYSNO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|