C17H10Cl2N2O — CID 91675105
2-(2,3-dichlorophenyl)-6-pyrrol-1-yl-1,3-benzoxazole (PubChem CID 91675105) has the molecular formula C17H10Cl2N2O and a molecular weight of 329.19 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-6-pyrrol-1-yl-1,3-benzoxazole.
| Compound Name | 2-(2,3-dichlorophenyl)-6-pyrrol-1-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 91675105 |
| Molecular Formula | C17H10Cl2N2O |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-6-pyrrol-1-yl-1,3-benzoxazole |
| SMILES | Clc1cccc(-c2nc3ccc(-n4cccc4)cc3o2)c1Cl |
| InChI | InChI=1S/C17H10Cl2N2O/c18-13-5-3-4-12(16(13)19)17-20-14-7-6-11(10-15(14)22-17)21-8-1-2-9-21/h1-10H |
| InChIKey | SEUFYVLHPRZBIR-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |