C14H5Cl2F2NO2 — CID 21262496
2-(2,3-dichlorophenyl)-6,7-difluoro-3,1-benzoxazin-4-one (PubChem CID 21262496) has the molecular formula C14H5Cl2F2NO2 and a molecular weight of 328.10 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-6,7-difluoro-3,1-benzoxazin-4-one.
| Compound Name | 2-(2,3-dichlorophenyl)-6,7-difluoro-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 21262496 |
| Molecular Formula | C14H5Cl2F2NO2 |
| Molecular Weight | 328.10 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-6,7-difluoro-3,1-benzoxazin-4-one |
| SMILES | O=c1oc(-c2cccc(Cl)c2Cl)nc2cc(F)c(F)cc12 |
| InChI | InChI=1S/C14H5Cl2F2NO2/c15-8-3-1-2-6(12(8)16)13-19-11-5-10(18)9(17)4-7(11)14(20)21-13/h1-5H |
| InChIKey | UERJVBWSDMUJEC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.10 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |