C21H14ClNO2 — CID 23630817
6-(4-chlorophenyl)-2-(2-methylphenyl)-3,1-benzoxazin-4-one (PubChem CID 23630817) has the molecular formula C21H14ClNO2 and a molecular weight of 347.80 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2-(2-methylphenyl)-3,1-benzoxazin-4-one.
| Compound Name | 6-(4-chlorophenyl)-2-(2-methylphenyl)-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 23630817 |
| Molecular Formula | C21H14ClNO2 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 6-(4-chlorophenyl)-2-(2-methylphenyl)-3,1-benzoxazin-4-one |
| SMILES | Cc1ccccc1-c1nc2ccc(-c3ccc(Cl)cc3)cc2c(=O)o1 |
| InChI | InChI=1S/C21H14ClNO2/c1-13-4-2-3-5-17(13)20-23-19-11-8-15(12-18(19)21(24)25-20)14-6-9-16(22)10-7-14/h2-12H,1H3 |
| InChIKey | JCOVQWVKRYPNJQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |