C14H7BrFNO2 — CID 132786054
6-bromo-2-(2-fluorophenyl)-3,1-benzoxazin-4-one (PubChem CID 132786054) has the molecular formula C14H7BrFNO2 and a molecular weight of 320.12 g/mol. Its IUPAC name is 6-bromo-2-(2-fluorophenyl)-3,1-benzoxazin-4-one.
| Compound Name | 6-bromo-2-(2-fluorophenyl)-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 132786054 |
| Molecular Formula | C14H7BrFNO2 |
| Molecular Weight | 320.12 g/mol |
| Exact Mass | 318.96 |
| IUPAC Name | 6-bromo-2-(2-fluorophenyl)-3,1-benzoxazin-4-one |
| SMILES | O=c1oc(-c2ccccc2F)nc2ccc(Br)cc12 |
| InChI | InChI=1S/C14H7BrFNO2/c15-8-5-6-12-10(7-8)14(18)19-13(17-12)9-3-1-2-4-11(9)16/h1-7H |
| InChIKey | XAXIVDTZVLGJIE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.12 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |