C16H8BrNO3 — CID 9323110
2-(1-benzofuran-2-yl)-6-bromo-3,1-benzoxazin-4-one (PubChem CID 9323110) has the molecular formula C16H8BrNO3 and a molecular weight of 342.15 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-6-bromo-3,1-benzoxazin-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-6-bromo-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 9323110 |
| Molecular Formula | C16H8BrNO3 |
| Molecular Weight | 342.15 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-6-bromo-3,1-benzoxazin-4-one |
| SMILES | O=c1oc(-c2cc3ccccc3o2)nc2ccc(Br)cc12 |
| InChI | InChI=1S/C16H8BrNO3/c17-10-5-6-12-11(8-10)16(19)21-15(18-12)14-7-9-3-1-2-4-13(9)20-14/h1-8H |
| InChIKey | YMWYXASSYJQVRJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.15 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |