C15H9NO2 — CID 9323121
2-(1-benzofuran-2-yl)-1,3-benzoxazole (PubChem CID 9323121) has the molecular formula C15H9NO2 and a molecular weight of 235.24 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-1,3-benzoxazole.
| Compound Name | 2-(1-benzofuran-2-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 9323121 |
| Molecular Formula | C15H9NO2 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-1,3-benzoxazole |
| SMILES | c1ccc2oc(-c3nc4ccccc4o3)cc2c1 |
| InChI | InChI=1S/C15H9NO2/c1-3-7-12-10(5-1)9-14(17-12)15-16-11-6-2-4-8-13(11)18-15/h1-9H |
| InChIKey | HKAUXZQQHXNRCR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |