C20H12N2O2 — CID 86184221
2,5-bis(1-benzofuran-2-yl)pyrazine (PubChem CID 86184221) has the molecular formula C20H12N2O2 and a molecular weight of 312.33 g/mol. Its IUPAC name is 2,5-bis(1-benzofuran-2-yl)pyrazine.
| Compound Name | 2,5-bis(1-benzofuran-2-yl)pyrazine |
|---|---|
| PubChem CID | 86184221 |
| Molecular Formula | C20H12N2O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2,5-bis(1-benzofuran-2-yl)pyrazine |
| SMILES | c1ccc2oc(-c3cnc(-c4cc5ccccc5o4)cn3)cc2c1 |
| InChI | InChI=1S/C20H12N2O2/c1-3-7-17-13(5-1)9-19(23-17)15-11-22-16(12-21-15)20-10-14-6-2-4-8-18(14)24-20/h1-12H |
| InChIKey | ONSAKUGNLCNRBI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |