C19H10ClN3O2 — CID 176645637
2,4-bis(1-benzofuran-2-yl)-6-chloro-1,3,5-triazine (PubChem CID 176645637) has the molecular formula C19H10ClN3O2 and a molecular weight of 347.76 g/mol. Its IUPAC name is 2,4-bis(1-benzofuran-2-yl)-6-chloro-1,3,5-triazine.
| Compound Name | 2,4-bis(1-benzofuran-2-yl)-6-chloro-1,3,5-triazine |
|---|---|
| PubChem CID | 176645637 |
| Molecular Formula | C19H10ClN3O2 |
| Molecular Weight | 347.76 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 2,4-bis(1-benzofuran-2-yl)-6-chloro-1,3,5-triazine |
| SMILES | Clc1nc(-c2cc3ccccc3o2)nc(-c2cc3ccccc3o2)n1 |
| InChI | InChI=1S/C19H10ClN3O2/c20-19-22-17(15-9-11-5-1-3-7-13(11)24-15)21-18(23-19)16-10-12-6-2-4-8-14(12)25-16/h1-10H |
| InChIKey | UZJVYECTYBJDLS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.76 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |