C14H11ClN2O — CID 114734051
2-(1-benzofuran-2-yl)-3-chloro-5,6-dimethylpyrazine (PubChem CID 114734051) has the molecular formula C14H11ClN2O and a molecular weight of 258.71 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-chloro-5,6-dimethylpyrazine.
| Compound Name | 2-(1-benzofuran-2-yl)-3-chloro-5,6-dimethylpyrazine |
|---|---|
| PubChem CID | 114734051 |
| Molecular Formula | C14H11ClN2O |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-chloro-5,6-dimethylpyrazine |
| SMILES | Cc1nc(Cl)c(-c2cc3ccccc3o2)nc1C |
| InChI | InChI=1S/C14H11ClN2O/c1-8-9(2)17-14(15)13(16-8)12-7-10-5-3-4-6-11(10)18-12/h3-7H,1-2H3 |
| InChIKey | OVXFXQHTFVDPNR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |