C15H12Cl2N2O — CID 102754018
6-(1-benzofuran-2-yl)-3,5-dichloro-N-ethylpyridin-2-amine (PubChem CID 102754018) has the molecular formula C15H12Cl2N2O and a molecular weight of 307.18 g/mol. Its IUPAC name is 6-(1-benzofuran-2-yl)-3,5-dichloro-N-ethylpyridin-2-amine.
| Compound Name | 6-(1-benzofuran-2-yl)-3,5-dichloro-N-ethylpyridin-2-amine |
|---|---|
| PubChem CID | 102754018 |
| Molecular Formula | C15H12Cl2N2O |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 6-(1-benzofuran-2-yl)-3,5-dichloro-N-ethylpyridin-2-amine |
| SMILES | CCNc1nc(-c2cc3ccccc3o2)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl2N2O/c1-2-18-15-11(17)8-10(16)14(19-15)13-7-9-5-3-4-6-12(9)20-13/h3-8H,2H2,1H3,(H,18,19) |
| InChIKey | BNWCXKJUSBXWMS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |