C12H11N3OS — CID 114734476
5-(1-benzofuran-2-yl)-N-ethyl-1,3,4-thiadiazol-2-amine (PubChem CID 114734476) has the molecular formula C12H11N3OS and a molecular weight of 245.31 g/mol. Its IUPAC name is 5-(1-benzofuran-2-yl)-N-ethyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(1-benzofuran-2-yl)-N-ethyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 114734476 |
| Molecular Formula | C12H11N3OS |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 5-(1-benzofuran-2-yl)-N-ethyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCNc1nnc(-c2cc3ccccc3o2)s1 |
| InChI | InChI=1S/C12H11N3OS/c1-2-13-12-15-14-11(17-12)10-7-8-5-3-4-6-9(8)16-10/h3-7H,2H2,1H3,(H,13,15) |
| InChIKey | MPVGRKOWKMXZIP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |