C18H13N3O3S — CID 11013568
N-[5-(1-benzofuran-2-yl)-1,3,4-thiadiazol-2-yl]-2-phenoxyacetamide (PubChem CID 11013568) has the molecular formula C18H13N3O3S and a molecular weight of 351.39 g/mol. Its IUPAC name is N-[5-(1-benzofuran-2-yl)-1,3,4-thiadiazol-2-yl]-2-phenoxyacetamide.
| Compound Name | N-[5-(1-benzofuran-2-yl)-1,3,4-thiadiazol-2-yl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 11013568 |
| Molecular Formula | C18H13N3O3S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | N-[5-(1-benzofuran-2-yl)-1,3,4-thiadiazol-2-yl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)Nc1nnc(-c2cc3ccccc3o2)s1 |
| InChI | InChI=1S/C18H13N3O3S/c22-16(11-23-13-7-2-1-3-8-13)19-18-21-20-17(25-18)15-10-12-6-4-5-9-14(12)24-15/h1-10H,11H2,(H,19,21,22) |
| InChIKey | FBLNROPLWTYOML-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |