C10H5ClN2OS — CID 114734078
3-(1-benzofuran-2-yl)-4-chloro-1,2,5-thiadiazole (PubChem CID 114734078) has the molecular formula C10H5ClN2OS and a molecular weight of 236.68 g/mol. Its IUPAC name is 3-(1-benzofuran-2-yl)-4-chloro-1,2,5-thiadiazole.
| Compound Name | 3-(1-benzofuran-2-yl)-4-chloro-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 114734078 |
| Molecular Formula | C10H5ClN2OS |
| Molecular Weight | 236.68 g/mol |
| Exact Mass | 235.98 |
| IUPAC Name | 3-(1-benzofuran-2-yl)-4-chloro-1,2,5-thiadiazole |
| SMILES | Clc1nsnc1-c1cc2ccccc2o1 |
| InChI | InChI=1S/C10H5ClN2OS/c11-10-9(12-15-13-10)8-5-6-3-1-2-4-7(6)14-8/h1-5H |
| InChIKey | FPRWYLVIKDQDJY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.68 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |