C14H12ClN3O2 — CID 114734080
2-(1-benzofuran-2-yl)-4-chloro-6-propoxy-1,3,5-triazine (PubChem CID 114734080) has the molecular formula C14H12ClN3O2 and a molecular weight of 289.72 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-4-chloro-6-propoxy-1,3,5-triazine.
| Compound Name | 2-(1-benzofuran-2-yl)-4-chloro-6-propoxy-1,3,5-triazine |
|---|---|
| PubChem CID | 114734080 |
| Molecular Formula | C14H12ClN3O2 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-4-chloro-6-propoxy-1,3,5-triazine |
| SMILES | CCCOc1nc(Cl)nc(-c2cc3ccccc3o2)n1 |
| InChI | InChI=1S/C14H12ClN3O2/c1-2-7-19-14-17-12(16-13(15)18-14)11-8-9-5-3-4-6-10(9)20-11/h3-6,8H,2,7H2,1H3 |
| InChIKey | NZYOKYCZWVJPSP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |