C26H22ClN3OSi — CID 177087946
[3-[4-[4-(1-benzofuran-2-yl)phenyl]-6-chloro-1,3,5-triazin-2-yl]phenyl]-trimethylsilane (PubChem CID 177087946) has the molecular formula C26H22ClN3OSi and a molecular weight of 456.02 g/mol. Its IUPAC name is [3-[4-[4-(1-benzofuran-2-yl)phenyl]-6-chloro-1,3,5-triazin-2-yl]phenyl]-trimethylsilane.
| Compound Name | [3-[4-[4-(1-benzofuran-2-yl)phenyl]-6-chloro-1,3,5-triazin-2-yl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 177087946 |
| Molecular Formula | C26H22ClN3OSi |
| Molecular Weight | 456.02 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | [3-[4-[4-(1-benzofuran-2-yl)phenyl]-6-chloro-1,3,5-triazin-2-yl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1cccc(-c2nc(Cl)nc(-c3ccc(-c4cc5ccccc5o4)cc3)n2)c1 |
| InChI | InChI=1S/C26H22ClN3OSi/c1-32(2,3)21-9-6-8-20(15-21)25-28-24(29-26(27)30-25)18-13-11-17(12-14-18)23-16-19-7-4-5-10-22(19)31-23/h4-16H,1-3H3 |
| InChIKey | RLQRIAKXDRVIAN-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.02 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|