C23H18ClN3O — CID 142555495
2-chloro-4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazine;ethane (PubChem CID 142555495) has the molecular formula C23H18ClN3O and a molecular weight of 387.87 g/mol. Its IUPAC name is 2-chloro-4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazine;ethane.
| Compound Name | 2-chloro-4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazine;ethane |
|---|---|
| PubChem CID | 142555495 |
| Molecular Formula | C23H18ClN3O |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 2-chloro-4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazine;ethane |
| SMILES | CC.Clc1nc(-c2ccccc2)nc(-c2ccc3c(c2)oc2ccccc23)n1 |
| InChI | InChI=1S/C21H12ClN3O.C2H6/c22-21-24-19(13-6-2-1-3-7-13)23-20(25-21)14-10-11-16-15-8-4-5-9-17(15)26-18(16)12-14;1-2/h1-12H;1-2H3 |
| InChIKey | LKZRYGICZYWGPH-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |