C37H22ClN3O — CID 168845021
2-chloro-4-dibenzofuran-3-yl-6-[3-(6-phenylnaphthalen-2-yl)phenyl]-1,3,5-triazine (PubChem CID 168845021) has the molecular formula C37H22ClN3O and a molecular weight of 560.06 g/mol. Its IUPAC name is 2-chloro-4-dibenzofuran-3-yl-6-[3-(6-phenylnaphthalen-2-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-chloro-4-dibenzofuran-3-yl-6-[3-(6-phenylnaphthalen-2-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 168845021 |
| Molecular Formula | C37H22ClN3O |
| Molecular Weight | 560.06 g/mol |
| Exact Mass | 559.15 |
| IUPAC Name | 2-chloro-4-dibenzofuran-3-yl-6-[3-(6-phenylnaphthalen-2-yl)phenyl]-1,3,5-triazine |
| SMILES | Clc1nc(-c2cccc(-c3ccc4cc(-c5ccccc5)ccc4c3)c2)nc(-c2ccc3c(c2)oc2ccccc23)n1 |
| InChI | InChI=1S/C37H22ClN3O/c38-37-40-35(39-36(41-37)30-17-18-32-31-11-4-5-12-33(31)42-34(32)22-30)29-10-6-9-24(21-29)26-15-16-27-19-25(13-14-28(27)20-26)23-7-2-1-3-8-23/h1-22H |
| InChIKey | PUAORLHCVQCRSU-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.06 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |