C33H24ClN3Si — CID 161136668
[3-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)phenyl]-triphenylsilane (PubChem CID 161136668) has the molecular formula C33H24ClN3Si and a molecular weight of 526.12 g/mol. Its IUPAC name is [3-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)phenyl]-triphenylsilane.
| Compound Name | [3-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 161136668 |
| Molecular Formula | C33H24ClN3Si |
| Molecular Weight | 526.12 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | [3-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)phenyl]-triphenylsilane |
| SMILES | Clc1nc(-c2ccccc2)nc(-c2cccc([Si](c3ccccc3)(c3ccccc3)c3ccccc3)c2)n1 |
| InChI | InChI=1S/C33H24ClN3Si/c34-33-36-31(25-14-5-1-6-15-25)35-32(37-33)26-16-13-23-30(24-26)38(27-17-7-2-8-18-27,28-19-9-3-10-20-28)29-21-11-4-12-22-29/h1-24H |
| InChIKey | UOUKEGPOHWRKFU-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.12 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|