C40H30N2Si — CID 162701574
[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-triphenylsilane (PubChem CID 162701574) has the molecular formula C40H30N2Si and a molecular weight of 566.78 g/mol. Its IUPAC name is [3-(4,6-diphenylpyrimidin-2-yl)phenyl]-triphenylsilane.
| Compound Name | [3-(4,6-diphenylpyrimidin-2-yl)phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 162701574 |
| Molecular Formula | C40H30N2Si |
| Molecular Weight | 566.78 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | [3-(4,6-diphenylpyrimidin-2-yl)phenyl]-triphenylsilane |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3cccc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)c3)n2)cc1 |
| InChI | InChI=1S/C40H30N2Si/c1-6-17-31(18-7-1)38-30-39(32-19-8-2-9-20-32)42-40(41-38)33-21-16-28-37(29-33)43(34-22-10-3-11-23-34,35-24-12-4-13-25-35)36-26-14-5-15-27-36/h1-30H |
| InChIKey | RFCQTUBDUNCHGG-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.78 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|