C35H25N3Si — CID 164931591
6-phenyl-2-(3-triphenylsilylphenyl)pyrimidine-4-carbonitrile (PubChem CID 164931591) has the molecular formula C35H25N3Si and a molecular weight of 515.69 g/mol. Its IUPAC name is 6-phenyl-2-(3-triphenylsilylphenyl)pyrimidine-4-carbonitrile.
| Compound Name | 6-phenyl-2-(3-triphenylsilylphenyl)pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 164931591 |
| Molecular Formula | C35H25N3Si |
| Molecular Weight | 515.69 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 6-phenyl-2-(3-triphenylsilylphenyl)pyrimidine-4-carbonitrile |
| SMILES | N#Cc1cc(-c2ccccc2)nc(-c2cccc([Si](c3ccccc3)(c3ccccc3)c3ccccc3)c2)n1 |
| InChI | InChI=1S/C35H25N3Si/c36-26-29-25-34(27-14-5-1-6-15-27)38-35(37-29)28-16-13-23-33(24-28)39(30-17-7-2-8-18-30,31-19-9-3-10-20-31)32-21-11-4-12-22-32/h1-25H |
| InChIKey | RVFUSFSMOKQWRM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.69 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|