C53H39N3Si2 — CID 164931519
4,6-bis(3-triphenylsilylphenyl)pyrimidine-2-carbonitrile (PubChem CID 164931519) has the molecular formula C53H39N3Si2 and a molecular weight of 774.09 g/mol. Its IUPAC name is 4,6-bis(3-triphenylsilylphenyl)pyrimidine-2-carbonitrile.
| Compound Name | 4,6-bis(3-triphenylsilylphenyl)pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 164931519 |
| Molecular Formula | C53H39N3Si2 |
| Molecular Weight | 774.09 g/mol |
| Exact Mass | 773.27 |
| IUPAC Name | 4,6-bis(3-triphenylsilylphenyl)pyrimidine-2-carbonitrile |
| SMILES | N#Cc1nc(-c2cccc([Si](c3ccccc3)(c3ccccc3)c3ccccc3)c2)cc(-c2cccc([Si](c3ccccc3)(c3ccccc3)c3ccccc3)c2)n1 |
| InChI | InChI=1S/C53H39N3Si2/c54-40-53-55-51(41-21-19-35-49(37-41)57(43-23-7-1-8-24-43,44-25-9-2-10-26-44)45-27-11-3-12-28-45)39-52(56-53)42-22-20-36-50(38-42)58(46-29-13-4-14-30-46,47-31-15-5-16-32-47)48-33-17-6-18-34-48/h1-39H |
| InChIKey | DIMHDAYGBPKDHK-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.09 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|