C76H54N2Si — CID 177078988
[3-[2,5-diphenyl-3-[4-[3-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]phenyl]phenyl]phenyl]-triphenylsilane (PubChem CID 177078988) has the molecular formula C76H54N2Si and a molecular weight of 1023.37 g/mol. Its IUPAC name is [3-[2,5-diphenyl-3-[4-[3-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]phenyl]phenyl]phenyl]-triphenylsilane.
| Compound Name | [3-[2,5-diphenyl-3-[4-[3-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]phenyl]phenyl]phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 177078988 |
| Molecular Formula | C76H54N2Si |
| Molecular Weight | 1023.37 g/mol |
| Exact Mass | 1022.41 |
| IUPAC Name | [3-[2,5-diphenyl-3-[4-[3-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]phenyl]phenyl]phenyl]-triphenylsilane |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4cccc(-c5ccc(-c6cc(-c7ccccc7)cc(-c7cccc([Si](c8ccccc8)(c8ccccc8)c8ccccc8)c7)c6-c6ccccc6)cc5)c4)nc(-c4ccccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C76H54N2Si/c1-8-24-55(25-9-1)57-44-48-60(49-45-57)73-54-74(78-76(77-73)62-30-14-4-15-31-62)65-34-22-32-63(50-65)58-42-46-59(47-43-58)71-52-66(56-26-10-2-11-27-56)53-72(75(71)61-28-12-3-13-29-61)64-33-23-41-70(51-64)79(67-35-16-5-17-36-67,68-37-18-6-19-38-68)69-39-20-7-21-40-69/h1-54H |
| InChIKey | PQWLWKMWROTJPR-UHFFFAOYSA-N |
| XLogP | 16.86 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1023.37 |
| LogP ≤ 5 | 16.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|