C58H38N2O — CID 177079224
4-[3-[3-(3-dibenzofuran-2-yl-2,5-diphenylphenyl)phenyl]phenyl]-2,6-diphenylpyrimidine (PubChem CID 177079224) has the molecular formula C58H38N2O and a molecular weight of 778.96 g/mol. Its IUPAC name is 4-[3-[3-(3-dibenzofuran-2-yl-2,5-diphenylphenyl)phenyl]phenyl]-2,6-diphenylpyrimidine.
| Compound Name | 4-[3-[3-(3-dibenzofuran-2-yl-2,5-diphenylphenyl)phenyl]phenyl]-2,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 177079224 |
| Molecular Formula | C58H38N2O |
| Molecular Weight | 778.96 g/mol |
| Exact Mass | 778.30 |
| IUPAC Name | 4-[3-[3-(3-dibenzofuran-2-yl-2,5-diphenylphenyl)phenyl]phenyl]-2,6-diphenylpyrimidine |
| SMILES | c1ccc(-c2cc(-c3cccc(-c4cccc(-c5cc(-c6ccccc6)nc(-c6ccccc6)n5)c4)c3)c(-c3ccccc3)c(-c3ccc4oc5ccccc5c4c3)c2)cc1 |
| InChI | InChI=1S/C58H38N2O/c1-5-17-39(18-6-1)48-36-50(57(41-21-9-3-10-22-41)51(37-48)46-31-32-56-52(35-46)49-29-13-14-30-55(49)61-56)45-27-15-25-43(33-45)44-26-16-28-47(34-44)54-38-53(40-19-7-2-8-20-40)59-58(60-54)42-23-11-4-12-24-42/h1-38H |
| InChIKey | NMVJKKVWGBMPQT-UHFFFAOYSA-N |
| XLogP | 15.71 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.96 |
| LogP ≤ 5 | 15.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |