C74H48N4O — CID 153316082
4-[3-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]-5-dibenzofuran-2-ylphenyl]-2,6-bis(4-phenylphenyl)pyrimidine (PubChem CID 153316082) has the molecular formula C74H48N4O and a molecular weight of 1009.23 g/mol. Its IUPAC name is 4-[3-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]-5-dibenzofuran-2-ylphenyl]-2,6-bis(4-phenylphenyl)pyrimidine.
| Compound Name | 4-[3-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]-5-dibenzofuran-2-ylphenyl]-2,6-bis(4-phenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 153316082 |
| Molecular Formula | C74H48N4O |
| Molecular Weight | 1009.23 g/mol |
| Exact Mass | 1008.38 |
| IUPAC Name | 4-[3-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]-5-dibenzofuran-2-ylphenyl]-2,6-bis(4-phenylphenyl)pyrimidine |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4cc(-c5ccc6oc7ccccc7c6c5)cc(-c5cc(-c6ccc(-c7ccccc7)cc6)nc(-c6ccc(-c7ccccc7)cc6)n5)c4)nc(-c4ccc(-c5ccccc5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C74H48N4O/c1-5-15-49(16-6-1)53-25-33-57(34-26-53)67-47-69(77-73(75-67)59-37-29-55(30-38-59)51-19-9-3-10-20-51)63-43-62(61-41-42-72-66(46-61)65-23-13-14-24-71(65)79-72)44-64(45-63)70-48-68(58-35-27-54(28-36-58)50-17-7-2-8-18-50)76-74(78-70)60-39-31-56(32-40-60)52-21-11-4-12-22-52/h1-48H |
| InChIKey | NEWXSOPRIQEYCU-UHFFFAOYSA-N |
| XLogP | 19.50 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1009.23 |
| LogP ≤ 5 | 19.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |