C52H34N2O — CID 153316090
2-dibenzofuran-2-yl-4,6-bis(3,5-diphenylphenyl)pyrimidine (PubChem CID 153316090) has the molecular formula C52H34N2O and a molecular weight of 702.86 g/mol. Its IUPAC name is 2-dibenzofuran-2-yl-4,6-bis(3,5-diphenylphenyl)pyrimidine.
| Compound Name | 2-dibenzofuran-2-yl-4,6-bis(3,5-diphenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 153316090 |
| Molecular Formula | C52H34N2O |
| Molecular Weight | 702.86 g/mol |
| Exact Mass | 702.27 |
| IUPAC Name | 2-dibenzofuran-2-yl-4,6-bis(3,5-diphenylphenyl)pyrimidine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3cc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)nc(-c4ccc5oc6ccccc6c5c4)n3)c2)cc1 |
| InChI | InChI=1S/C52H34N2O/c1-5-15-35(16-6-1)40-27-41(36-17-7-2-8-18-36)30-44(29-40)48-34-49(54-52(53-48)39-25-26-51-47(33-39)46-23-13-14-24-50(46)55-51)45-31-42(37-19-9-3-10-20-37)28-43(32-45)38-21-11-4-12-22-38/h1-34H |
| InChIKey | JRRVHUGMYSEZTE-UHFFFAOYSA-N |
| XLogP | 14.05 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.86 |
| LogP ≤ 5 | 14.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |