C61H49NSi2 — CID 155622012
[3-[4-(2,6-dimethylphenyl)-6-(3-triphenylsilylphenyl)-2-pyridinyl]phenyl]-triphenylsilane (PubChem CID 155622012) has the molecular formula C61H49NSi2 and a molecular weight of 852.24 g/mol. Its IUPAC name is [3-[4-(2,6-dimethylphenyl)-6-(3-triphenylsilylphenyl)-2-pyridinyl]phenyl]-triphenylsilane.
| Compound Name | [3-[4-(2,6-dimethylphenyl)-6-(3-triphenylsilylphenyl)-2-pyridinyl]phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 155622012 |
| Molecular Formula | C61H49NSi2 |
| Molecular Weight | 852.24 g/mol |
| Exact Mass | 851.34 |
| IUPAC Name | [3-[4-(2,6-dimethylphenyl)-6-(3-triphenylsilylphenyl)-2-pyridinyl]phenyl]-triphenylsilane |
| SMILES | Cc1cccc(C)c1-c1cc(-c2cccc([Si](c3ccccc3)(c3ccccc3)c3ccccc3)c2)nc(-c2cccc([Si](c3ccccc3)(c3ccccc3)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C61H49NSi2/c1-46-24-21-25-47(2)61(46)50-44-59(48-26-22-40-57(42-48)63(51-28-9-3-10-29-51,52-30-11-4-12-31-52)53-32-13-5-14-33-53)62-60(45-50)49-27-23-41-58(43-49)64(54-34-15-6-16-35-54,55-36-17-7-18-37-55)56-38-19-8-20-39-56/h3-45H,1-2H3 |
| InChIKey | YYZQCRHSGTYZKH-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.24 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|