C55H44Si2 — CID 170660172
[3-[diphenyl-(3-phenylphenyl)silyl]-5-methylphenyl]-diphenyl-(3-phenylphenyl)silane (PubChem CID 170660172) has the molecular formula C55H44Si2 and a molecular weight of 761.13 g/mol. Its IUPAC name is [3-[diphenyl-(3-phenylphenyl)silyl]-5-methylphenyl]-diphenyl-(3-phenylphenyl)silane.
| Compound Name | [3-[diphenyl-(3-phenylphenyl)silyl]-5-methylphenyl]-diphenyl-(3-phenylphenyl)silane |
|---|---|
| PubChem CID | 170660172 |
| Molecular Formula | C55H44Si2 |
| Molecular Weight | 761.13 g/mol |
| Exact Mass | 760.30 |
| IUPAC Name | [3-[diphenyl-(3-phenylphenyl)silyl]-5-methylphenyl]-diphenyl-(3-phenylphenyl)silane |
| SMILES | Cc1cc([Si](c2ccccc2)(c2ccccc2)c2cccc(-c3ccccc3)c2)cc([Si](c2ccccc2)(c2ccccc2)c2cccc(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C55H44Si2/c1-43-38-54(56(48-28-12-4-13-29-48,49-30-14-5-15-31-49)52-36-20-26-46(40-52)44-22-8-2-9-23-44)42-55(39-43)57(50-32-16-6-17-33-50,51-34-18-7-19-35-51)53-37-21-27-47(41-53)45-24-10-3-11-25-45/h2-42H,1H3 |
| InChIKey | JKKXGHDGCAOXEZ-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.13 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|