C54H41BrSi2 — CID 168800170
[3-bromo-2,4,6-trideuterio-5-[diphenyl-(3-phenylphenyl)silyl]phenyl]-diphenyl-(3-phenylphenyl)silane (PubChem CID 168800170) has the molecular formula C54H41BrSi2 and a molecular weight of 829.02 g/mol. Its IUPAC name is [3-bromo-2,4,6-trideuterio-5-[diphenyl-(3-phenylphenyl)silyl]phenyl]-diphenyl-(3-phenylphenyl)silane.
| Compound Name | [3-bromo-2,4,6-trideuterio-5-[diphenyl-(3-phenylphenyl)silyl]phenyl]-diphenyl-(3-phenylphenyl)silane |
|---|---|
| PubChem CID | 168800170 |
| Molecular Formula | C54H41BrSi2 |
| Molecular Weight | 829.02 g/mol |
| Exact Mass | 827.21 |
| IUPAC Name | [3-bromo-2,4,6-trideuterio-5-[diphenyl-(3-phenylphenyl)silyl]phenyl]-diphenyl-(3-phenylphenyl)silane |
| SMILES | [2H]c1c(Br)c([2H])c([Si](c2ccccc2)(c2ccccc2)c2cccc(-c3ccccc3)c2)c([2H])c1[Si](c1ccccc1)(c1ccccc1)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C54H41BrSi2/c55-46-39-53(56(47-27-11-3-12-28-47,48-29-13-4-14-30-48)51-35-19-25-44(37-51)42-21-7-1-8-22-42)41-54(40-46)57(49-31-15-5-16-32-49,50-33-17-6-18-34-50)52-36-20-26-45(38-52)43-23-9-2-10-24-43/h1-41H/i39D,40D,41D |
| InChIKey | MJJMGMHPOXFTLD-UIICBMKKSA-N |
| XLogP | 8.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.02 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|