C30H23BrSi — CID 164843260
(3-bromo-2,4,5,6-tetradeuteriophenyl)-[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-diphenylsilane (PubChem CID 164843260) has the molecular formula C30H23BrSi and a molecular weight of 500.56 g/mol. Its IUPAC name is (3-bromo-2,4,5,6-tetradeuteriophenyl)-[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-diphenylsilane.
| Compound Name | (3-bromo-2,4,5,6-tetradeuteriophenyl)-[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-diphenylsilane |
|---|---|
| PubChem CID | 164843260 |
| Molecular Formula | C30H23BrSi |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | (3-bromo-2,4,5,6-tetradeuteriophenyl)-[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-diphenylsilane |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc([Si](c3ccccc3)(c3ccccc3)c3c([2H])c([2H])c([2H])c(Br)c3[2H])c2)c([2H])c1[2H] |
| InChI | InChI=1S/C30H23BrSi/c31-26-15-11-21-30(23-26)32(27-16-6-2-7-17-27,28-18-8-3-9-19-28)29-20-10-14-25(22-29)24-12-4-1-5-13-24/h1-23H/i1D,4D,5D,11D,12D,13D,15D,21D,23D |
| InChIKey | QLCBOFAYPPINFR-ZJLMRXPHSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|